C16H30O8 — CID 88656789
bis(ethane-1,2-diol);4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate (PubChem CID 88656789) has the molecular formula C16H30O8 and a molecular weight of 350.41 g/mol. Its IUPAC name is bis(ethane-1,2-diol);4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate.
| Compound Name | bis(ethane-1,2-diol);4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88656789 |
| Molecular Formula | C16H30O8 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | bis(ethane-1,2-diol);4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)C(=C)C.OCCO.OCCO |
| InChI | InChI=1S/C12H18O4.2C2H6O2/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4;2*3-1-2-4/h1,3,5-8H2,2,4H3;2*3-4H,1-2H2 |
| InChIKey | UMIGHGAJBJZCLU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|