C15H30O3 — CID 118690093
butan-1-ol;heptyl 2-methylprop-2-enoate (PubChem CID 118690093) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is butan-1-ol;heptyl 2-methylprop-2-enoate.
| Compound Name | butan-1-ol;heptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118690093 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | butan-1-ol;heptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC.CCCCO |
| InChI | InChI=1S/C11H20O2.C4H10O/c1-4-5-6-7-8-9-13-11(12)10(2)3;1-2-3-4-5/h2,4-9H2,1,3H3;5H,2-4H2,1H3 |
| InChIKey | KDKRIZHBXFPOJQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|