C18H32O5 — CID 22757411
2-hydroxyethyl 2-methylprop-2-enoate;octyl 2-methylprop-2-enoate (PubChem CID 22757411) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;octyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22757411 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCC.C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C12H22O2.C6H10O3/c1-4-5-6-7-8-9-10-14-12(13)11(2)3;1-5(2)6(8)9-4-3-7/h2,4-10H2,1,3H3;7H,1,3-4H2,2H3 |
| InChIKey | FUJRSZIEFDRRLH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|