C28H44O8 — CID 88685309
ethene;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate (PubChem CID 88685309) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is ethene;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate.
| Compound Name | ethene;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88685309 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | ethene;4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C(C)C(=O)OCCCCCCOC(=O)C(=C)C.C=C(C)C(=O)OCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C14H22O4.C12H18O4.C2H4/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4;1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4;1-2/h1,3,5-10H2,2,4H3;1,3,5-8H2,2,4H3;1-2H2 |
| InChIKey | CUQCZQSXNLNZOI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|