C30H54O4 — CID 173009937
ethene;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate (PubChem CID 173009937) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is ethene;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate.
| Compound Name | ethene;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173009937 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | ethene;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C.C=C(C)C(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C10H14O4.10C2H4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;10*1-2/h1,3,5-6H2,2,4H3;10*1-2H2 |
| InChIKey | DFPWLUMZTGSWRB-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|