C14H24O3 — CID 67714172
butyl 2-methylprop-2-enoate;cyclohexanone (PubChem CID 67714172) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;cyclohexanone.
| Compound Name | butyl 2-methylprop-2-enoate;cyclohexanone |
|---|---|
| PubChem CID | 67714172 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | butyl 2-methylprop-2-enoate;cyclohexanone |
| SMILES | C=C(C)C(=O)OCCCC.O=C1CCCCC1 |
| InChI | InChI=1S/C8H14O2.C6H10O/c1-4-5-6-10-8(9)7(2)3;7-6-4-2-1-3-5-6/h2,4-6H2,1,3H3;1-5H2 |
| InChIKey | ZXCOHELXKZEBMD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|