C13H24O6 — CID 90200711
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate;oxolane (PubChem CID 90200711) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate;oxolane.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate;oxolane |
|---|---|
| PubChem CID | 90200711 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-methylprop-2-enoate;oxolane |
| SMILES | C1CCOC1.C=C(C)C(=O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C9H16O5.C4H8O/c1-7(2)8(13)14-6-9(3-10,4-11)5-12;1-2-4-5-3-1/h10-12H,1,3-6H2,2H3;1-4H2 |
| InChIKey | QFEBFCXOBXVFOY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|