C12H20O6 — CID 89388463
[2,2-bis(hydroxymethyl)-3-(oxiran-2-ylmethoxy)propyl] 2-methylprop-2-enoate (PubChem CID 89388463) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is [2,2-bis(hydroxymethyl)-3-(oxiran-2-ylmethoxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-bis(hydroxymethyl)-3-(oxiran-2-ylmethoxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89388463 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [2,2-bis(hydroxymethyl)-3-(oxiran-2-ylmethoxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)(CO)COCC1CO1 |
| InChI | InChI=1S/C12H20O6/c1-9(2)11(15)18-8-12(5-13,6-14)7-16-3-10-4-17-10/h10,13-14H,1,3-8H2,2H3 |
| InChIKey | DNAWGRVCIOCCFC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|