About formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate
formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 159353031) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 159353031 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=O |
| InChI | InChI=1S/C7H10O3.CH2O/c1-5(2)7(8)10-4-6-3-9-6;1-2/h6H,1,3-4H2,2H3;1H2 |
| InChIKey | LHOKZMFVUMGREI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 159353031) is formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC1CO1.C=O.
What is the InChIKey of formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is LHOKZMFVUMGREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.CH2O/c1-5(2)7(8)10-4-6-3-9-6;1-2/h6H,1,3-4H2,2H3;1H2.
What are the key properties of formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate?
formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 172.18 g/mol, XLogP of 0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 159353031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).