C12H19NO4 — CID 158470137
3-methylbut-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 158470137) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-methylbut-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 3-methylbut-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158470137 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-methylbut-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.CC(C)=CC(N)=O |
| InChI | InChI=1S/C7H10O3.C5H9NO/c1-5(2)7(8)10-4-6-3-9-6;1-4(2)3-5(6)7/h6H,1,3-4H2,2H3;3H,1-2H3,(H2,6,7) |
| InChIKey | HGGDJNNXJUBMJG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|