About ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate
ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 174820350) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 174820350 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C.C=C(C)C(=O)OCC1CO1.CCOC(C)=O |
| InChI | InChI=1S/C7H10O3.C4H8O2.CH4/c1-5(2)7(8)10-4-6-3-9-6;1-3-6-4(2)5;/h6H,1,3-4H2,2H3;3H2,1-2H3;1H4 |
| InChIKey | BJWKWXXDRBFQRX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 174820350) is ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate is C.C=C(C)C(=O)OCC1CO1.CCOC(C)=O.
What is the InChIKey of ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is BJWKWXXDRBFQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C4H8O2.CH4/c1-5(2)7(8)10-4-6-3-9-6;1-3-6-4(2)5;/h6H,1,3-4H2,2H3;3H2,1-2H3;1H4.
What are the key properties of ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 246.30 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;methane;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 174820350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).