C18H28O8 — CID 86750009
2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 86750009) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86750009 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCC1CO1.C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C7H10O3.C6H10O3.C5H8O2/c1-5(2)7(8)10-4-6-3-9-6;1-5(2)6(8)9-4-3-7;1-4(2)5(6)7-3/h6H,1,3-4H2,2H3;7H,1,3-4H2,2H3;1H2,2-3H3 |
| InChIKey | RCBCZBWPDNVLGP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|