C9H16O5 — CID 131732609
2-hydroxyethyl 2-methylprop-2-enoate;oxiran-2-ylmethanol (PubChem CID 131732609) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;oxiran-2-ylmethanol.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;oxiran-2-ylmethanol |
|---|---|
| PubChem CID | 131732609 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;oxiran-2-ylmethanol |
| SMILES | C=C(C)C(=O)OCCO.OCC1CO1 |
| InChI | InChI=1S/C6H10O3.C3H6O2/c1-5(2)6(8)9-4-3-7;4-1-3-2-5-3/h7H,1,3-4H2,2H3;3-4H,1-2H2 |
| InChIKey | OUKBFYXABNYYDR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|