C13H21NO5 — CID 173160147
2-hydroxyethyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enamide (PubChem CID 173160147) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enamide.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 173160147 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enamide |
| SMILES | C=C(C)C(=O)OCCO.CC(=CCC1CO1)C(N)=O |
| InChI | InChI=1S/C7H11NO2.C6H10O3/c1-5(7(8)9)2-3-6-4-10-6;1-5(2)6(8)9-4-3-7/h2,6H,3-4H2,1H3,(H2,8,9);7H,1,3-4H2,2H3 |
| InChIKey | GMFLVBFEFMVKEL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|