C14H22O7 — CID 175776964
2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (PubChem CID 175776964) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.
| Compound Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 175776964 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(O)CO.CC(=CCC1CO1)C(=O)O |
| InChI | InChI=1S/C7H12O4.C7H10O3/c1-5(2)7(10)11-4-6(9)3-8;1-5(7(8)9)2-3-6-4-10-6/h6,8-9H,1,3-4H2,2H3;2,6H,3-4H2,1H3,(H,8,9) |
| InChIKey | CZMXGIPTZZQZLY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|