About 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid
2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (PubChem CID 175776964) has the molecular formula C14H22O7
and a molecular weight of 302.32 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.
Molecular Properties
| Compound Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
| PubChem CID | 175776964 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC(O)CO.CC(=CCC1CO1)C(=O)O |
| InChI | InChI=1S/C7H12O4.C7H10O3/c1-5(2)7(10)11-4-6(9)3-8;1-5(7(8)9)2-3-6-4-10-6/h6,8-9H,1,3-4H2,2H3;2,6H,3-4H2,1H3,(H,8,9) |
| InChIKey | CZMXGIPTZZQZLY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The IUPAC name of 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid (CID 175776964) is 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid.
What is the SMILES notation for 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The canonical SMILES for 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid is C=C(C)C(=O)OCC(O)CO.CC(=CCC1CO1)C(=O)O.
What is the InChIKey of 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
The InChIKey is CZMXGIPTZZQZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.C7H10O3/c1-5(2)7(10)11-4-6(9)3-8;1-5(7(8)9)2-3-6-4-10-6/h6,8-9H,1,3-4H2,2H3;2,6H,3-4H2,1H3,(H,8,9).
What are the key properties of 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid?
2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid has a molecular weight of 302.32 g/mol, XLogP of 0.27, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxypropyl 2-methylprop-2-enoate;2-methyl-4-(oxiran-2-yl)but-2-enoic acid is sourced from PubChem (CID 175776964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).