C14H18O8 — CID 174823242
4-(2,3-dihydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid (PubChem CID 174823242) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid.
| Compound Name | 4-(2,3-dihydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid |
|---|---|
| PubChem CID | 174823242 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(2,3-dihydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid |
| SMILES | CC(=CC=C(C=C(C)C(=O)O)C(=O)OCC(O)CO)C(=O)O |
| InChI | InChI=1S/C14H18O8/c1-8(12(17)18)3-4-10(5-9(2)13(19)20)14(21)22-7-11(16)6-15/h3-5,11,15-16H,6-7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | FJBGLVSTGBOBJS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|