4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid

C7H10O6 — CID 54038335

IUPAC4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)OCC(O)CO
InChIInChI=1S/C7H10O6/c8-3-5(9)4-13-7(12)2-1-6(10)11/h1-2,5,8-9H,3-4H2,(H,10,11)
InChIKeyLKNWQTLPRGTVEO-UHFFFAOYSA-N
MW190.15 g/mol
LogP-1.48
Rot. Bonds5

About 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid

4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid (PubChem CID 54038335) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid
PubChem CID54038335
Molecular FormulaC7H10O6
Molecular Weight190.15 g/mol
Exact Mass190.05
IUPAC Name4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)OCC(O)CO
InChIInChI=1S/C7H10O6/c8-3-5(9)4-13-7(12)2-1-6(10)11/h1-2,5,8-9H,3-4H2,(H,10,11)
InChIKeyLKNWQTLPRGTVEO-UHFFFAOYSA-N
XLogP-1.48
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 5-1.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid?
The IUPAC name of 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid (CID 54038335) is 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid is O=C(O)C=CC(=O)OCC(O)CO.
What is the InChIKey of 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid?
The InChIKey is LKNWQTLPRGTVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O6/c8-3-5(9)4-13-7(12)2-1-6(10)11/h1-2,5,8-9H,3-4H2,(H,10,11).
What are the key properties of 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid?
4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid has a molecular weight of 190.15 g/mol, XLogP of -1.48, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid is sourced from PubChem (CID 54038335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).