C7H10O6 — CID 54038335
4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid (PubChem CID 54038335) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid.
| Compound Name | 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54038335 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 4-(2,3-dihydroxypropoxy)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)OCC(O)CO |
| InChI | InChI=1S/C7H10O6/c8-3-5(9)4-13-7(12)2-1-6(10)11/h1-2,5,8-9H,3-4H2,(H,10,11) |
| InChIKey | LKNWQTLPRGTVEO-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|