C10H12O7 — CID 90382332
(Z)-4-(2-hydroxy-3-prop-2-enoyloxypropoxy)-4-oxobut-2-enoic acid (PubChem CID 90382332) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is (Z)-4-(2-hydroxy-3-prop-2-enoyloxypropoxy)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2-hydroxy-3-prop-2-enoyloxypropoxy)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90382332 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (Z)-4-(2-hydroxy-3-prop-2-enoyloxypropoxy)-4-oxobut-2-enoic acid |
| SMILES | C=CC(=O)OCC(O)COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C10H12O7/c1-2-9(14)16-5-7(11)6-17-10(15)4-3-8(12)13/h2-4,7,11H,1,5-6H2,(H,12,13)/b4-3- |
| InChIKey | HZYVDJPBIUNTFA-ARJAWSKDSA-N |
| XLogP | -0.74 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|