C11H12O8 — CID 89216787
(Z)-4-[2-hydroxy-3-[(Z)-4-oxobut-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid (PubChem CID 89216787) has the molecular formula C11H12O8 and a molecular weight of 272.21 g/mol. Its IUPAC name is (Z)-4-[2-hydroxy-3-[(Z)-4-oxobut-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[2-hydroxy-3-[(Z)-4-oxobut-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 89216787 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (Z)-4-[2-hydroxy-3-[(Z)-4-oxobut-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C/C=C\C(=O)OCC(O)COC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H12O8/c12-5-1-2-10(16)18-6-8(13)7-19-11(17)4-3-9(14)15/h1-5,8,13H,6-7H2,(H,14,15)/b2-1-,4-3- |
| InChIKey | LKHCKDJPKKAXJB-LOKDLIDFSA-N |
| XLogP | -1.17 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|