C11H12O8 — CID 6446969
(E)-4-[2-[(E)-3-carboxyprop-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid (PubChem CID 6446969) has the molecular formula C11H12O8 and a molecular weight of 272.21 g/mol. Its IUPAC name is (E)-4-[2-[(E)-3-carboxyprop-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[(E)-3-carboxyprop-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 6446969 |
| Molecular Formula | C11H12O8 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (E)-4-[2-[(E)-3-carboxyprop-2-enoyl]oxypropoxy]-4-oxobut-2-enoic acid |
| SMILES | CC(COC(=O)/C=C/C(=O)O)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H12O8/c1-7(19-11(17)5-3-9(14)15)6-18-10(16)4-2-8(12)13/h2-5,7H,6H2,1H3,(H,12,13)(H,14,15)/b4-2+,5-3+ |
| InChIKey | UWAPZLSSQZOFLR-ZUVMSYQZSA-N |
| XLogP | -0.26 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|