C26H38N2O17 — CID 101285938
(Z)-4-[1-[2-[bis[2-[(Z)-3-carboxyprop-2-enoyl]oxypropoxy]amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoic acid (PubChem CID 101285938) has the molecular formula C26H38N2O17 and a molecular weight of 650.59 g/mol. Its IUPAC name is (Z)-4-[1-[2-[bis[2-[(Z)-3-carboxyprop-2-enoyl]oxypropoxy]amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[1-[2-[bis[2-[(Z)-3-carboxyprop-2-enoyl]oxypropoxy]amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 101285938 |
| Molecular Formula | C26H38N2O17 |
| Molecular Weight | 650.59 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | (Z)-4-[1-[2-[bis[2-[(Z)-3-carboxyprop-2-enoyl]oxypropoxy]amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoic acid |
| SMILES | CC(O)CON(CCN(OCC(C)OC(=O)/C=C\C(=O)O)OCC(C)OC(=O)/C=C\C(=O)O)OCC(C)OC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H38N2O17/c1-17(29)13-39-27(40-14-18(2)43-24(36)8-5-21(30)31)11-12-28(41-15-19(3)44-25(37)9-6-22(32)33)42-16-20(4)45-26(38)10-7-23(34)35/h5-10,17-20,29H,11-16H2,1-4H3,(H,30,31)(H,32,33)(H,34,35)/b8-5-,9-6-,10-7- |
| InChIKey | OGSVOLAZEWTYLX-PRMANMLGSA-N |
| XLogP | -0.58 |
| TPSA | 254.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.59 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|