C18H33N2NaO11 — CID 102118611
sodium (Z)-4-[1-[2-[bis(2-hydroxypropoxy)amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoate (PubChem CID 102118611) has the molecular formula C18H33N2NaO11 and a molecular weight of 476.46 g/mol. Its IUPAC name is sodium (Z)-4-[1-[2-[bis(2-hydroxypropoxy)amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoate.
| Compound Name | sodium (Z)-4-[1-[2-[bis(2-hydroxypropoxy)amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 102118611 |
| Molecular Formula | C18H33N2NaO11 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | sodium (Z)-4-[1-[2-[bis(2-hydroxypropoxy)amino]ethyl-(2-hydroxypropoxy)amino]oxypropan-2-yloxy]-4-oxobut-2-enoate |
| SMILES | CC(O)CON(CCN(OCC(C)O)OCC(C)OC(=O)/C=C\C(=O)[O-])OCC(C)O.[Na+] |
| InChI | InChI=1S/C18H34N2O11.Na/c1-13(21)9-27-19(28-10-14(2)22)7-8-20(29-11-15(3)23)30-12-16(4)31-18(26)6-5-17(24)25;/h5-6,13-16,21-23H,7-12H2,1-4H3,(H,24,25);/q;+1/p-1/b6-5-; |
| InChIKey | DEDNAVIBQLVBIR-YSMBQZINSA-M |
| XLogP | -5.30 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|