About 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate
4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate (PubChem CID 154093639) has the molecular formula C7H6F3O4-
and a molecular weight of 211.11 g/mol. Its IUPAC name is 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate.
Molecular Properties
| Compound Name | 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate |
| PubChem CID | 154093639 |
| Molecular Formula | C7H6F3O4- |
| Molecular Weight | 211.11 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate |
| SMILES | CC(OC(=O)C=CC(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C7H7F3O4/c1-4(7(8,9)10)14-6(13)3-2-5(11)12/h2-4H,1H3,(H,11,12)/p-1 |
| InChIKey | CGRBYQFBGWYUAP-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.11 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate?
The IUPAC name of 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate (CID 154093639) is 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate.
What is the SMILES notation for 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate?
The canonical SMILES for 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate is CC(OC(=O)C=CC(=O)[O-])C(F)(F)F.
What is the InChIKey of 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate?
The InChIKey is CGRBYQFBGWYUAP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7F3O4/c1-4(7(8,9)10)14-6(13)3-2-5(11)12/h2-4H,1H3,(H,11,12)/p-1.
What are the key properties of 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate?
4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate has a molecular weight of 211.11 g/mol, XLogP of -0.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-(1,1,1-trifluoropropan-2-yloxy)but-2-enoate is sourced from PubChem (CID 154093639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).