About (E)-but-2-enedioate
(E)-but-2-enedioate (PubChem CID 5460307) has the molecular formula C4H2O4-2
and a molecular weight of 114.06 g/mol. Its IUPAC name is (E)-but-2-enedioate.
Molecular Properties
| Compound Name | (E)-but-2-enedioate |
| PubChem CID | 5460307 |
| Molecular Formula | C4H2O4-2 |
| Molecular Weight | 114.06 g/mol |
| Exact Mass | 114.00 |
| IUPAC Name | (E)-but-2-enedioate |
| SMILES | O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1+ |
| InChIKey | VZCYOOQTPOCHFL-OWOJBTEDSA-L |
| XLogP | -2.96 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.06 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioate?
The IUPAC name of (E)-but-2-enedioate (CID 5460307) is (E)-but-2-enedioate.
What is the SMILES notation for (E)-but-2-enedioate?
The canonical SMILES for (E)-but-2-enedioate is O=C([O-])/C=C/C(=O)[O-].
What is the InChIKey of (E)-but-2-enedioate?
The InChIKey is VZCYOOQTPOCHFL-OWOJBTEDSA-L. The full InChI is InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/p-2/b2-1+.
What are the key properties of (E)-but-2-enedioate?
(E)-but-2-enedioate has a molecular weight of 114.06 g/mol, XLogP of -2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioate is sourced from PubChem (CID 5460307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).