About beryllium (Z)-but-2-enedioate
beryllium (Z)-but-2-enedioate (PubChem CID 140577680) has the molecular formula C4H2BeO4
and a molecular weight of 123.07 g/mol. Its IUPAC name is beryllium (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | beryllium (Z)-but-2-enedioate |
| PubChem CID | 140577680 |
| Molecular Formula | C4H2BeO4 |
| Molecular Weight | 123.07 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | beryllium (Z)-but-2-enedioate |
| SMILES | O=C([O-])/C=C\C(=O)[O-].[Be+2] |
| InChI | InChI=1S/C4H4O4.Be/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1-; |
| InChIKey | WWJPNKYMEIATMF-ODZAUARKSA-L |
| XLogP | -3.34 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.07 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze beryllium (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium (Z)-but-2-enedioate?
The IUPAC name of beryllium (Z)-but-2-enedioate (CID 140577680) is beryllium (Z)-but-2-enedioate.
What is the SMILES notation for beryllium (Z)-but-2-enedioate?
The canonical SMILES for beryllium (Z)-but-2-enedioate is O=C([O-])/C=C\C(=O)[O-].[Be+2].
What is the InChIKey of beryllium (Z)-but-2-enedioate?
The InChIKey is WWJPNKYMEIATMF-ODZAUARKSA-L. The full InChI is InChI=1S/C4H4O4.Be/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1-;.
What are the key properties of beryllium (Z)-but-2-enedioate?
beryllium (Z)-but-2-enedioate has a molecular weight of 123.07 g/mol, XLogP of -3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium (Z)-but-2-enedioate is sourced from PubChem (CID 140577680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).