About calcium;but-2-enedioate;trihydrate
calcium;but-2-enedioate;trihydrate (PubChem CID 74057853) has the molecular formula C4H8CaO7
and a molecular weight of 208.18 g/mol. Its IUPAC name is calcium;but-2-enedioate;trihydrate.
Molecular Properties
| Compound Name | calcium;but-2-enedioate;trihydrate |
| PubChem CID | 74057853 |
| Molecular Formula | C4H8CaO7 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | calcium;but-2-enedioate;trihydrate |
| SMILES | O.O.O.O=C([O-])C=CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H4O4.Ca.3H2O/c5-3(6)1-2-4(7)8;;;;/h1-2H,(H,5,6)(H,7,8);;3*1H2/q;+2;;;/p-2 |
| InChIKey | XQEDIRAPXZMGHH-UHFFFAOYSA-L |
| XLogP | -5.81 |
| TPSA | 174.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze calcium;but-2-enedioate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;but-2-enedioate;trihydrate?
The IUPAC name of calcium;but-2-enedioate;trihydrate (CID 74057853) is calcium;but-2-enedioate;trihydrate.
What is the SMILES notation for calcium;but-2-enedioate;trihydrate?
The canonical SMILES for calcium;but-2-enedioate;trihydrate is O.O.O.O=C([O-])C=CC(=O)[O-].[Ca+2].
What is the InChIKey of calcium;but-2-enedioate;trihydrate?
The InChIKey is XQEDIRAPXZMGHH-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H4O4.Ca.3H2O/c5-3(6)1-2-4(7)8;;;;/h1-2H,(H,5,6)(H,7,8);;3*1H2/q;+2;;;/p-2.
What are the key properties of calcium;but-2-enedioate;trihydrate?
calcium;but-2-enedioate;trihydrate has a molecular weight of 208.18 g/mol, XLogP of -5.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;but-2-enedioate;trihydrate is sourced from PubChem (CID 74057853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).