About disodium;(Z)-but-2-enedioate;dihydrate
disodium;(Z)-but-2-enedioate;dihydrate (PubChem CID 90473230) has the molecular formula C4H6Na2O6
and a molecular weight of 196.07 g/mol. Its IUPAC name is disodium;(Z)-but-2-enedioate;dihydrate.
Molecular Properties
| Compound Name | disodium;(Z)-but-2-enedioate;dihydrate |
| PubChem CID | 90473230 |
| Molecular Formula | C4H6Na2O6 |
| Molecular Weight | 196.07 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | disodium;(Z)-but-2-enedioate;dihydrate |
| SMILES | O.O.O=C([O-])/C=C\C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O4.2Na.2H2O/c5-3(6)1-2-4(7)8;;;;/h1-2H,(H,5,6)(H,7,8);;;2*1H2/q;2*+1;;/p-2/b2-1-;;;; |
| InChIKey | IBVHJKDBSOUFSS-SQDRRJMKSA-L |
| XLogP | -10.60 |
| TPSA | 143.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.07 |
| LogP ≤ 5 | -10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;(Z)-but-2-enedioate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(Z)-but-2-enedioate;dihydrate?
The IUPAC name of disodium;(Z)-but-2-enedioate;dihydrate (CID 90473230) is disodium;(Z)-but-2-enedioate;dihydrate.
What is the SMILES notation for disodium;(Z)-but-2-enedioate;dihydrate?
The canonical SMILES for disodium;(Z)-but-2-enedioate;dihydrate is O.O.O=C([O-])/C=C\C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(Z)-but-2-enedioate;dihydrate?
The InChIKey is IBVHJKDBSOUFSS-SQDRRJMKSA-L. The full InChI is InChI=1S/C4H4O4.2Na.2H2O/c5-3(6)1-2-4(7)8;;;;/h1-2H,(H,5,6)(H,7,8);;;2*1H2/q;2*+1;;/p-2/b2-1-;;;;.
What are the key properties of disodium;(Z)-but-2-enedioate;dihydrate?
disodium;(Z)-but-2-enedioate;dihydrate has a molecular weight of 196.07 g/mol, XLogP of -10.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(Z)-but-2-enedioate;dihydrate is sourced from PubChem (CID 90473230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).