About disodium;(Z)-but-2-enedioate
disodium;(Z)-but-2-enedioate (PubChem CID 6364608) has the molecular formula C4H2Na2O4
and a molecular weight of 160.04 g/mol. Its IUPAC name is disodium;(Z)-but-2-enedioate.
Molecular Properties
| Compound Name | disodium;(Z)-but-2-enedioate |
| PubChem CID | 6364608 |
| Molecular Formula | C4H2Na2O4 |
| Molecular Weight | 160.04 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | disodium;(Z)-but-2-enedioate |
| SMILES | O=C([O-])/C=C\C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/b2-1-;; |
| InChIKey | MSJMDZAOKORVFC-UAIGNFCESA-L |
| XLogP | -8.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.04 |
| LogP ≤ 5 | -8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;(Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(Z)-but-2-enedioate?
The IUPAC name of disodium;(Z)-but-2-enedioate (CID 6364608) is disodium;(Z)-but-2-enedioate.
What is the SMILES notation for disodium;(Z)-but-2-enedioate?
The canonical SMILES for disodium;(Z)-but-2-enedioate is O=C([O-])/C=C\C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(Z)-but-2-enedioate?
The InChIKey is MSJMDZAOKORVFC-UAIGNFCESA-L. The full InChI is InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/b2-1-;;.
What are the key properties of disodium;(Z)-but-2-enedioate?
disodium;(Z)-but-2-enedioate has a molecular weight of 160.04 g/mol, XLogP of -8.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(Z)-but-2-enedioate is sourced from PubChem (CID 6364608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).