C4H2Na2O4 — CID 118797082
disodium;(2,3-13C2)but-2-enedioate (PubChem CID 118797082) has the molecular formula C4H2Na2O4 and a molecular weight of 162.02 g/mol. Its IUPAC name is disodium;(2,3-13C2)but-2-enedioate.
| Compound Name | disodium;(2,3-13C2)but-2-enedioate |
|---|---|
| PubChem CID | 118797082 |
| Molecular Formula | C4H2Na2O4 |
| Molecular Weight | 162.02 g/mol |
| Exact Mass | 161.98 |
| IUPAC Name | disodium;(2,3-13C2)but-2-enedioate |
| SMILES | O=C([O-])[13CH]=[13CH]C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O4.2Na/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/i1+1,2+1;; |
| InChIKey | MSJMDZAOKORVFC-BQTCFENJSA-L |
| XLogP | -8.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.02 |
| LogP ≤ 5 | -8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|