About bis((Z)-but-2-enedioate);copper
bis((Z)-but-2-enedioate);copper (PubChem CID 172736667) has the molecular formula C8H4CuO8-4
and a molecular weight of 291.66 g/mol. Its IUPAC name is bis((Z)-but-2-enedioate);copper.
Molecular Properties
| Compound Name | bis((Z)-but-2-enedioate);copper |
| PubChem CID | 172736667 |
| Molecular Formula | C8H4CuO8-4 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 290.92 |
| IUPAC Name | bis((Z)-but-2-enedioate);copper |
| SMILES | O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-].[Cu] |
| InChI | InChI=1S/2C4H4O4.Cu/c2*5-3(6)1-2-4(7)8;/h2*1-2H,(H,5,6)(H,7,8);/p-4/b2*2-1-; |
| InChIKey | LHTKSVDHPJCWIW-PAMPIZDHSA-J |
| XLogP | -5.92 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | -5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-but-2-enedioate);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-but-2-enedioate);copper?
The IUPAC name of bis((Z)-but-2-enedioate);copper (CID 172736667) is bis((Z)-but-2-enedioate);copper.
What is the SMILES notation for bis((Z)-but-2-enedioate);copper?
The canonical SMILES for bis((Z)-but-2-enedioate);copper is O=C([O-])/C=C\C(=O)[O-].O=C([O-])/C=C\C(=O)[O-].[Cu].
What is the InChIKey of bis((Z)-but-2-enedioate);copper?
The InChIKey is LHTKSVDHPJCWIW-PAMPIZDHSA-J. The full InChI is InChI=1S/2C4H4O4.Cu/c2*5-3(6)1-2-4(7)8;/h2*1-2H,(H,5,6)(H,7,8);/p-4/b2*2-1-;.
What are the key properties of bis((Z)-but-2-enedioate);copper?
bis((Z)-but-2-enedioate);copper has a molecular weight of 291.66 g/mol, XLogP of -5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-but-2-enedioate);copper is sourced from PubChem (CID 172736667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).