About cesium;(Z)-but-2-enedioate;molybdenum(4+)
cesium;(Z)-but-2-enedioate;molybdenum(4+) (PubChem CID 175894957) has the molecular formula C4H2CsMoO4+3
and a molecular weight of 342.90 g/mol. Its IUPAC name is cesium;(Z)-but-2-enedioate;molybdenum(4+).
Molecular Properties
| Compound Name | cesium;(Z)-but-2-enedioate;molybdenum(4+) |
| PubChem CID | 175894957 |
| Molecular Formula | C4H2CsMoO4+3 |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 344.80 |
| IUPAC Name | cesium;(Z)-but-2-enedioate;molybdenum(4+) |
| SMILES | O=C([O-])/C=C\C(=O)[O-].[Cs+].[Mo+4] |
| InChI | InChI=1S/C4H4O4.Cs.Mo/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;+1;+4/p-2/b2-1-;; |
| InChIKey | FNXDWXLHLUGHSG-UAIGNFCESA-L |
| XLogP | -5.96 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cesium;(Z)-but-2-enedioate;molybdenum(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;(Z)-but-2-enedioate;molybdenum(4+)?
The IUPAC name of cesium;(Z)-but-2-enedioate;molybdenum(4+) (CID 175894957) is cesium;(Z)-but-2-enedioate;molybdenum(4+).
What is the SMILES notation for cesium;(Z)-but-2-enedioate;molybdenum(4+)?
The canonical SMILES for cesium;(Z)-but-2-enedioate;molybdenum(4+) is O=C([O-])/C=C\C(=O)[O-].[Cs+].[Mo+4].
What is the InChIKey of cesium;(Z)-but-2-enedioate;molybdenum(4+)?
The InChIKey is FNXDWXLHLUGHSG-UAIGNFCESA-L. The full InChI is InChI=1S/C4H4O4.Cs.Mo/c5-3(6)1-2-4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;+1;+4/p-2/b2-1-;;.
What are the key properties of cesium;(Z)-but-2-enedioate;molybdenum(4+)?
cesium;(Z)-but-2-enedioate;molybdenum(4+) has a molecular weight of 342.90 g/mol, XLogP of -5.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;(Z)-but-2-enedioate;molybdenum(4+) is sourced from PubChem (CID 175894957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).