About but-2-enedioate;manganese(2+)
but-2-enedioate;manganese(2+) (PubChem CID 57354505) has the molecular formula C4H2MnO4
and a molecular weight of 168.99 g/mol. Its IUPAC name is but-2-enedioate;manganese(2+).
Molecular Properties
| Compound Name | but-2-enedioate;manganese(2+) |
| PubChem CID | 57354505 |
| Molecular Formula | C4H2MnO4 |
| Molecular Weight | 168.99 g/mol |
| Exact Mass | 168.93 |
| IUPAC Name | but-2-enedioate;manganese(2+) |
| SMILES | O=C([O-])C=CC(=O)[O-].[Mn+2] |
| InChI | InChI=1S/C4H4O4.Mn/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | PCDVXBKFEVKXMQ-UHFFFAOYSA-L |
| XLogP | -2.96 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.99 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioate;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioate;manganese(2+)?
The IUPAC name of but-2-enedioate;manganese(2+) (CID 57354505) is but-2-enedioate;manganese(2+).
What is the SMILES notation for but-2-enedioate;manganese(2+)?
The canonical SMILES for but-2-enedioate;manganese(2+) is O=C([O-])C=CC(=O)[O-].[Mn+2].
What is the InChIKey of but-2-enedioate;manganese(2+)?
The InChIKey is PCDVXBKFEVKXMQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H4O4.Mn/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2.
What are the key properties of but-2-enedioate;manganese(2+)?
but-2-enedioate;manganese(2+) has a molecular weight of 168.99 g/mol, XLogP of -2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioate;manganese(2+) is sourced from PubChem (CID 57354505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).