About disodium;but-2-enedioate;oxalic acid
disodium;but-2-enedioate;oxalic acid (PubChem CID 162123312) has the molecular formula C6H4Na2O8
and a molecular weight of 250.07 g/mol. Its IUPAC name is disodium;but-2-enedioate;oxalic acid.
Molecular Properties
| Compound Name | disodium;but-2-enedioate;oxalic acid |
| PubChem CID | 162123312 |
| Molecular Formula | C6H4Na2O8 |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | disodium;but-2-enedioate;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C([O-])C=CC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O4.C2H2O4.2Na/c5-3(6)1-2-4(7)8;3-1(4)2(5)6;;/h1-2H,(H,5,6)(H,7,8);(H,3,4)(H,5,6);;/q;;2*+1/p-2 |
| InChIKey | ZHRUPFUPIWLNIS-UHFFFAOYSA-L |
| XLogP | -9.79 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | -9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;but-2-enedioate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;but-2-enedioate;oxalic acid?
The IUPAC name of disodium;but-2-enedioate;oxalic acid (CID 162123312) is disodium;but-2-enedioate;oxalic acid.
What is the SMILES notation for disodium;but-2-enedioate;oxalic acid?
The canonical SMILES for disodium;but-2-enedioate;oxalic acid is O=C(O)C(=O)O.O=C([O-])C=CC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;but-2-enedioate;oxalic acid?
The InChIKey is ZHRUPFUPIWLNIS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H4O4.C2H2O4.2Na/c5-3(6)1-2-4(7)8;3-1(4)2(5)6;;/h1-2H,(H,5,6)(H,7,8);(H,3,4)(H,5,6);;/q;;2*+1/p-2.
What are the key properties of disodium;but-2-enedioate;oxalic acid?
disodium;but-2-enedioate;oxalic acid has a molecular weight of 250.07 g/mol, XLogP of -9.79, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;but-2-enedioate;oxalic acid is sourced from PubChem (CID 162123312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).