C9H11NaO6 — CID 140738806
sodium (E)-4-(2-methylpropanoyloxymethoxy)-4-oxobut-2-enoate (PubChem CID 140738806) has the molecular formula C9H11NaO6 and a molecular weight of 238.17 g/mol. Its IUPAC name is sodium (E)-4-(2-methylpropanoyloxymethoxy)-4-oxobut-2-enoate.
| Compound Name | sodium (E)-4-(2-methylpropanoyloxymethoxy)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 140738806 |
| Molecular Formula | C9H11NaO6 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | sodium (E)-4-(2-methylpropanoyloxymethoxy)-4-oxobut-2-enoate |
| SMILES | CC(C)C(=O)OCOC(=O)/C=C/C(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H12O6.Na/c1-6(2)9(13)15-5-14-8(12)4-3-7(10)11;/h3-4,6H,5H2,1-2H3,(H,10,11);/q;+1/p-1/b4-3+; |
| InChIKey | ZPKVKEBODWVLOL-BJILWQEISA-M |
| XLogP | -4.00 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|