C15H18N2O7 — CID 122463778
1-O-[(2-methylidene-4-oxo-1H-pyrimidin-5-yl)methyl] 4-O-(2-methylpropanoyloxymethyl) (E)-but-2-enedioate (PubChem CID 122463778) has the molecular formula C15H18N2O7 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-O-[(2-methylidene-4-oxo-1H-pyrimidin-5-yl)methyl] 4-O-(2-methylpropanoyloxymethyl) (E)-but-2-enedioate.
| Compound Name | 1-O-[(2-methylidene-4-oxo-1H-pyrimidin-5-yl)methyl] 4-O-(2-methylpropanoyloxymethyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122463778 |
| Molecular Formula | C15H18N2O7 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1-O-[(2-methylidene-4-oxo-1H-pyrimidin-5-yl)methyl] 4-O-(2-methylpropanoyloxymethyl) (E)-but-2-enedioate |
| SMILES | C=C1NC=C(COC(=O)/C=C/C(=O)OCOC(=O)C(C)C)C(=O)N1 |
| InChI | InChI=1S/C15H18N2O7/c1-9(2)15(21)24-8-23-13(19)5-4-12(18)22-7-11-6-16-10(3)17-14(11)20/h4-6,9,16H,3,7-8H2,1-2H3,(H,17,20)/b5-4+ |
| InChIKey | HTGUXGMBQQYHTL-SNAWJCMRSA-N |
| XLogP | -0.14 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|