C19H22N4O7 — CID 122463757
4-O-[3-(2,4-dioxo-1H-pyrimidin-5-yl)propyl] 1-O-[3-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)propyl] (E)-but-2-enedioate (PubChem CID 122463757) has the molecular formula C19H22N4O7 and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-O-[3-(2,4-dioxo-1H-pyrimidin-5-yl)propyl] 1-O-[3-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)propyl] (E)-but-2-enedioate.
| Compound Name | 4-O-[3-(2,4-dioxo-1H-pyrimidin-5-yl)propyl] 1-O-[3-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)propyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122463757 |
| Molecular Formula | C19H22N4O7 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-O-[3-(2,4-dioxo-1H-pyrimidin-5-yl)propyl] 1-O-[3-(2-methylidene-4-oxo-1H-pyrimidin-5-yl)propyl] (E)-but-2-enedioate |
| SMILES | C=C1NC=C(CCCOC(=O)/C=C/C(=O)OCCCc2c[nH]c(=O)[nH]c2=O)C(=O)N1 |
| InChI | InChI=1S/C19H22N4O7/c1-12-20-10-13(17(26)22-12)4-2-8-29-15(24)6-7-16(25)30-9-3-5-14-11-21-19(28)23-18(14)27/h6-7,10-11,20H,1-5,8-9H2,(H,22,26)(H2,21,23,27,28)/b7-6+ |
| InChIKey | PNBRWTMLUUFPFW-VOTSOKGWSA-N |
| XLogP | -0.51 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|