C13H14N2O9 — CID 122667402
4-O-[3-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 122667402) has the molecular formula C13H14N2O9 and a molecular weight of 342.26 g/mol. Its IUPAC name is 4-O-[3-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122667402 |
| Molecular Formula | C13H14N2O9 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-O-[3-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-2-hydroxy-3-oxopropyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCC(O)C(=O)OCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H14N2O9/c1-22-9(17)2-3-10(18)23-6-8(16)12(20)24-5-7-4-14-13(21)15-11(7)19/h2-4,8,16H,5-6H2,1H3,(H2,14,15,19,21)/b3-2+ |
| InChIKey | SPPBZFQYNRTMHN-NSCUHMNNSA-N |
| XLogP | -2.26 |
| TPSA | 164.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|