C9H8N2O6 — CID 122443719
(E)-4-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-4-oxobut-2-enoic acid (PubChem CID 122443719) has the molecular formula C9H8N2O6 and a molecular weight of 240.17 g/mol. Its IUPAC name is (E)-4-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 122443719 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (E)-4-[(2,4-dioxo-1H-pyrimidin-5-yl)methoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H8N2O6/c12-6(13)1-2-7(14)17-4-5-3-10-9(16)11-8(5)15/h1-3H,4H2,(H,12,13)(H2,10,11,15,16)/b2-1+ |
| InChIKey | YEPPJSNDYPMVBF-OWOJBTEDSA-N |
| XLogP | -1.25 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|