C9H11BrN2O3 — CID 173248084
5-(4-bromobut-3-enoxymethyl)-1H-pyrimidine-2,4-dione (PubChem CID 173248084) has the molecular formula C9H11BrN2O3 and a molecular weight of 275.10 g/mol. Its IUPAC name is 5-(4-bromobut-3-enoxymethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(4-bromobut-3-enoxymethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173248084 |
| Molecular Formula | C9H11BrN2O3 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 5-(4-bromobut-3-enoxymethyl)-1H-pyrimidine-2,4-dione |
| SMILES | C1=C(C(=O)NC(=O)N1)COCCC=CBr |
| InChI | InChI=1S/C9H11BrN2O3/c10-3-1-2-4-15-6-7-5-11-9(14)12-8(7)13/h1,3,5H,2,4,6H2,(H2,11,12,13,14) |
| InChIKey | VRFIQTSRQBWREU-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 312 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|