C7H9BrN2O3 — CID 19802312
5-(2-bromo-1-methoxyethyl)-1H-pyrimidine-2,4-dione (PubChem CID 19802312) has the molecular formula C7H9BrN2O3 and a molecular weight of 249.06 g/mol. Its IUPAC name is 5-(2-bromo-1-methoxyethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-bromo-1-methoxyethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19802312 |
| Molecular Formula | C7H9BrN2O3 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-(2-bromo-1-methoxyethyl)-1H-pyrimidine-2,4-dione |
| SMILES | COC(CBr)C1=CNC(=O)NC1=O |
| InChI | InChI=1S/C7H9BrN2O3/c1-13-5(2-8)4-3-9-7(12)10-6(4)11/h3,5H,2H2,1H3,(H2,9,10,11,12) |
| InChIKey | YCBFIWSTJILEQQ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 264 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|