(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate

C8H8N2O4 — CID 67255423

IUPAC(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate
SMILESC=CC(=O)OCc1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C8H8N2O4/c1-2-6(11)14-4-5-3-9-8(13)10-7(5)12/h2-3H,1,4H2,(H2,9,10,12,13)
InChIKeyPRRJDSPQLXVQDY-UHFFFAOYSA-N
MW196.16 g/mol
LogP-0.71
Rot. Bonds3

About (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate

(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate (PubChem CID 67255423) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate.

Molecular Properties

Compound Name(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate
PubChem CID67255423
Molecular FormulaC8H8N2O4
Molecular Weight196.16 g/mol
Exact Mass196.05
IUPAC Name(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate
SMILESC=CC(=O)OCc1c[nH]c(=O)[nH]c1=O
InChIInChI=1S/C8H8N2O4/c1-2-6(11)14-4-5-3-9-8(13)10-7(5)12/h2-3H,1,4H2,(H2,9,10,12,13)
InChIKeyPRRJDSPQLXVQDY-UHFFFAOYSA-N
XLogP-0.71
TPSA92.02 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.16
LogP ≤ 5-0.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate?
The IUPAC name of (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate (CID 67255423) is (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate.
What is the SMILES notation for (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate?
The canonical SMILES for (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate is C=CC(=O)OCc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate?
The InChIKey is PRRJDSPQLXVQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4/c1-2-6(11)14-4-5-3-9-8(13)10-7(5)12/h2-3H,1,4H2,(H2,9,10,12,13).
What are the key properties of (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate?
(2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate has a molecular weight of 196.16 g/mol, XLogP of -0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxo-1H-pyrimidin-5-yl)methyl prop-2-enoate is sourced from PubChem (CID 67255423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).