C14H20N2O4 — CID 10978846
[(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] 2,2-dimethylpropanoate (PubChem CID 10978846) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10978846 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [(Z)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] 2,2-dimethylpropanoate |
| SMILES | Cc1cn(C/C=C\COC(=O)C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N2O4/c1-10-9-16(13(19)15-11(10)17)7-5-6-8-20-12(18)14(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,15,17,19)/b6-5- |
| InChIKey | CGHDSAIDSNNGFT-WAYWQWQTSA-N |
| XLogP | 0.99 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|