C11H15FN2O3 — CID 70964470
1-[(E)-5-fluoro-3-(hydroxymethyl)pent-2-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 70964470) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is 1-[(E)-5-fluoro-3-(hydroxymethyl)pent-2-enyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(E)-5-fluoro-3-(hydroxymethyl)pent-2-enyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70964470 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1-[(E)-5-fluoro-3-(hydroxymethyl)pent-2-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C/C=C(/CO)CCF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15FN2O3/c1-8-6-14(11(17)13-10(8)16)5-3-9(7-15)2-4-12/h3,6,15H,2,4-5,7H2,1H3,(H,13,16,17)/b9-3+ |
| InChIKey | UECWMBGAIVXUPM-YCRREMRBSA-N |
| XLogP | 0.12 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|