C10H18FN2O5P — CID 142308782
1-(3-fluoropropyl)-5-methylpyrimidine-2,4-dione;methoxymethylphosphonous acid (PubChem CID 142308782) has the molecular formula C10H18FN2O5P and a molecular weight of 296.24 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-5-methylpyrimidine-2,4-dione;methoxymethylphosphonous acid.
| Compound Name | 1-(3-fluoropropyl)-5-methylpyrimidine-2,4-dione;methoxymethylphosphonous acid |
|---|---|
| PubChem CID | 142308782 |
| Molecular Formula | C10H18FN2O5P |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 1-(3-fluoropropyl)-5-methylpyrimidine-2,4-dione;methoxymethylphosphonous acid |
| SMILES | COCP(O)O.Cc1cn(CCCF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11FN2O2.C2H7O3P/c1-6-5-11(4-2-3-9)8(13)10-7(6)12;1-5-2-6(3)4/h5H,2-4H2,1H3,(H,10,12,13);3-4H,2H2,1H3 |
| InChIKey | VBNNVAOYUPYZPU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|