C8H9BF3KN2O2 — CID 106746423
potassium trifluoro-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-1-en-2-yl]boranuide (PubChem CID 106746423) has the molecular formula C8H9BF3KN2O2 and a molecular weight of 272.08 g/mol. Its IUPAC name is potassium trifluoro-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-1-en-2-yl]boranuide.
| Compound Name | potassium trifluoro-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746423 |
| Molecular Formula | C8H9BF3KN2O2 |
| Molecular Weight | 272.08 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | potassium trifluoro-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)prop-1-en-2-yl]boranuide |
| SMILES | C=C(Cn1cc(C)c(=O)[nH]c1=O)[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C8H9BF3N2O2.K/c1-5-3-14(8(16)13-7(5)15)4-6(2)9(10,11)12;/h3H,2,4H2,1H3,(H,13,15,16);/q-1;+1 |
| InChIKey | NKXNZLVWQGOGGM-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.08 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|