C14H15N3O3 — CID 35177235
2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(2-methylphenyl)acetamide (PubChem CID 35177235) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 35177235 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(5-methyl-2,4-dioxopyrimidin-1-yl)-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H15N3O3/c1-9-5-3-4-6-11(9)15-12(18)8-17-7-10(2)13(19)16-14(17)20/h3-7H,8H2,1-2H3,(H,15,18)(H,16,19,20) |
| InChIKey | NBLIJXNCBNFJNL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |