C8H10N2O4 — CID 3757668
methyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 3757668) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | methyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 3757668 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | methyl 2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | COC(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O4/c1-5-3-10(4-6(11)14-2)8(13)9-7(5)12/h3H,4H2,1-2H3,(H,9,12,13) |
| InChIKey | FACYKZIDLVIVDV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |