C14H21N3O3 — CID 60734726
N-cycloheptyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 60734726) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-cycloheptyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 60734726 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-cycloheptyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cc1cn(CC(=O)NC2CCCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O3/c1-10-8-17(14(20)16-13(10)19)9-12(18)15-11-6-4-2-3-5-7-11/h8,11H,2-7,9H2,1H3,(H,15,18)(H,16,19,20) |
| InChIKey | QZLJLJCVZIQLNG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |