C22H26N4O6 — CID 71727330
[4-[cyclohexyl-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]carbamoyl]phenyl] acetate (PubChem CID 71727330) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is [4-[cyclohexyl-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]carbamoyl]phenyl] acetate.
| Compound Name | [4-[cyclohexyl-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 71727330 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [4-[cyclohexyl-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N(NC(=O)Cn2cc(C)c(=O)[nH]c2=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N4O6/c1-14-12-25(22(31)23-20(14)29)13-19(28)24-26(17-6-4-3-5-7-17)21(30)16-8-10-18(11-9-16)32-15(2)27/h8-12,17H,3-7,13H2,1-2H3,(H,24,28)(H,23,29,31) |
| InChIKey | DQEBRWASQYQJCP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|