C15H23N3O4 — CID 154787984
N-cyclooctyl-2-(5-methoxy-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 154787984) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-cyclooctyl-2-(5-methoxy-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-cyclooctyl-2-(5-methoxy-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 154787984 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-cyclooctyl-2-(5-methoxy-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | COc1cn(CC(=O)NC2CCCCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23N3O4/c1-22-12-9-18(15(21)17-14(12)20)10-13(19)16-11-7-5-3-2-4-6-8-11/h9,11H,2-8,10H2,1H3,(H,16,19)(H,17,20,21) |
| InChIKey | LEIGJGLUDGIIPF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |